C15H11Cl2F3N2OS — CID 151524714
5-chloro-N-[5-chloro-2-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-7-yl]thiophene-2-carboxamide (PubChem CID 151524714) has the molecular formula C15H11Cl2F3N2OS and a molecular weight of 395.23 g/mol. Its IUPAC name is 5-chloro-N-[5-chloro-2-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-7-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[5-chloro-2-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-7-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 151524714 |
| Molecular Formula | C15H11Cl2F3N2OS |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 5-chloro-N-[5-chloro-2-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-7-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c2c(c1)CN(C(F)(F)F)CC2)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H11Cl2F3N2OS/c16-11-6-9(21-14(23)12-1-2-13(17)24-12)5-8-7-22(15(18,19)20)4-3-10(8)11/h1-2,5-6H,3-4,7H2,(H,21,23) |
| InChIKey | PVFAJVOXDGZLFI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|