C13H11ClN2OS — CID 63252721
5-chloro-N-(2,3-dihydro-1H-indol-5-yl)thiophene-2-carboxamide (PubChem CID 63252721) has the molecular formula C13H11ClN2OS and a molecular weight of 278.76 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dihydro-1H-indol-5-yl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(2,3-dihydro-1H-indol-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63252721 |
| Molecular Formula | C13H11ClN2OS |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 5-chloro-N-(2,3-dihydro-1H-indol-5-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCN2)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H11ClN2OS/c14-12-4-3-11(18-12)13(17)16-9-1-2-10-8(7-9)5-6-15-10/h1-4,7,15H,5-6H2,(H,16,17) |
| InChIKey | DFHYNSFFJLJIHU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |