C15H13ClN2O — CID 55169715
3-chloro-N-(2,3-dihydro-1H-indol-5-yl)benzamide (PubChem CID 55169715) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is 3-chloro-N-(2,3-dihydro-1H-indol-5-yl)benzamide.
| Compound Name | 3-chloro-N-(2,3-dihydro-1H-indol-5-yl)benzamide |
|---|---|
| PubChem CID | 55169715 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3-chloro-N-(2,3-dihydro-1H-indol-5-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)CCN2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13ClN2O/c16-12-3-1-2-11(8-12)15(19)18-13-4-5-14-10(9-13)6-7-17-14/h1-5,8-9,17H,6-7H2,(H,18,19) |
| InChIKey | MXNPXRJZGPAXLS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |