C15H11F3N2O — CID 63252893
N-(2,3-dihydro-1H-indol-5-yl)-3,4,5-trifluorobenzamide (PubChem CID 63252893) has the molecular formula C15H11F3N2O and a molecular weight of 292.26 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-5-yl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(2,3-dihydro-1H-indol-5-yl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 63252893 |
| Molecular Formula | C15H11F3N2O |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-5-yl)-3,4,5-trifluorobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)CCN2)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H11F3N2O/c16-11-6-9(7-12(17)14(11)18)15(21)20-10-1-2-13-8(5-10)3-4-19-13/h1-2,5-7,19H,3-4H2,(H,20,21) |
| InChIKey | SYLAMMBRINOLFC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|