C15H13IN2O — CID 63252905
N-(2,3-dihydro-1H-indol-5-yl)-4-iodobenzamide (PubChem CID 63252905) has the molecular formula C15H13IN2O and a molecular weight of 364.19 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-5-yl)-4-iodobenzamide.
| Compound Name | N-(2,3-dihydro-1H-indol-5-yl)-4-iodobenzamide |
|---|---|
| PubChem CID | 63252905 |
| Molecular Formula | C15H13IN2O |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-5-yl)-4-iodobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)CCN2)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H13IN2O/c16-12-3-1-10(2-4-12)15(19)18-13-5-6-14-11(9-13)7-8-17-14/h1-6,9,17H,7-8H2,(H,18,19) |
| InChIKey | SMAJGLUFJIQMLM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|