C17H18N2O2 — CID 61237345
N-[4-(2-hydroxyethyl)phenyl]-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 61237345) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[4-(2-hydroxyethyl)phenyl]-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | N-[4-(2-hydroxyethyl)phenyl]-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 61237345 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-[4-(2-hydroxyethyl)phenyl]-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | O=C(Nc1ccc(CCO)cc1)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C17H18N2O2/c20-10-8-12-1-4-15(5-2-12)19-17(21)14-3-6-16-13(11-14)7-9-18-16/h1-6,11,18,20H,7-10H2,(H,19,21) |
| InChIKey | XYEBGZKKSATDHK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |