About N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide
N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide (PubChem CID 119473764) has the molecular formula C19H22N2O3
and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide |
| PubChem CID | 119473764 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc3c(c2)CCN3)cc1OCC |
| InChI | InChI=1S/C19H22N2O3/c1-3-23-17-8-5-14(12-18(17)24-4-2)19(22)21-15-6-7-16-13(11-15)9-10-20-16/h5-8,11-12,20H,3-4,9-10H2,1-2H3,(H,21,22) |
| InChIKey | YXCSEFLWMJVONK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide?
The IUPAC name of N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide (CID 119473764) is N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide.
What is the SMILES notation for N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide?
The canonical SMILES for N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide is CCOc1ccc(C(=O)Nc2ccc3c(c2)CCN3)cc1OCC.
What is the InChIKey of N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide?
The InChIKey is YXCSEFLWMJVONK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3/c1-3-23-17-8-5-14(12-18(17)24-4-2)19(22)21-15-6-7-16-13(11-15)9-10-20-16/h5-8,11-12,20H,3-4,9-10H2,1-2H3,(H,21,22).
What are the key properties of N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide?
N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide has a molecular weight of 326.40 g/mol, XLogP of 3.70, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1H-indol-5-yl)-3,4-diethoxybenzamide is sourced from PubChem (CID 119473764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).