C17H15N3O — CID 61250452
N-(1H-indol-5-yl)-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 61250452) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is N-(1H-indol-5-yl)-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | N-(1H-indol-5-yl)-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 61250452 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(1H-indol-5-yl)-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]ccc2c1)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C17H15N3O/c21-17(13-1-3-15-11(9-13)5-7-18-15)20-14-2-4-16-12(10-14)6-8-19-16/h1-4,6,8-10,18-19H,5,7H2,(H,20,21) |
| InChIKey | CVJRGFBIHYHDNZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |