C13H10Cl2N2OS — CID 103806044
2,5-dichloro-N-(2,3-dihydro-1H-indol-5-yl)thiophene-3-carboxamide (PubChem CID 103806044) has the molecular formula C13H10Cl2N2OS and a molecular weight of 313.21 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,3-dihydro-1H-indol-5-yl)thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(2,3-dihydro-1H-indol-5-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103806044 |
| Molecular Formula | C13H10Cl2N2OS |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 2,5-dichloro-N-(2,3-dihydro-1H-indol-5-yl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCN2)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C13H10Cl2N2OS/c14-11-6-9(12(15)19-11)13(18)17-8-1-2-10-7(5-8)3-4-16-10/h1-2,5-6,16H,3-4H2,(H,17,18) |
| InChIKey | XMRFTABPWWZFNR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |