C11H10N4OS — CID 65216392
N-(2,3-dihydro-1H-indol-5-yl)thiadiazole-4-carboxamide (PubChem CID 65216392) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-5-yl)thiadiazole-4-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-indol-5-yl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 65216392 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-5-yl)thiadiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCN2)c1csnn1 |
| InChI | InChI=1S/C11H10N4OS/c16-11(10-6-17-15-14-10)13-8-1-2-9-7(5-8)3-4-12-9/h1-2,5-6,12H,3-4H2,(H,13,16) |
| InChIKey | GSMZYZBDRGTANO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |