C16H14N2O5 — CID 110451899
5-[[2-(aminomethyl)benzoyl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 110451899) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 5-[[2-(aminomethyl)benzoyl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[2-(aminomethyl)benzoyl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 110451899 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 5-[[2-(aminomethyl)benzoyl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | NCc1ccccc1C(=O)Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C16H14N2O5/c17-8-9-3-1-2-4-13(9)14(19)18-12-6-10(15(20)21)5-11(7-12)16(22)23/h1-7H,8,17H2,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | DCJTUQQGEQOGGO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |