C16H13NO5 — CID 1369682
5-[(2-phenylacetyl)amino]benzene-1,3-dicarboxylic acid (PubChem CID 1369682) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 5-[(2-phenylacetyl)amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(2-phenylacetyl)amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 1369682 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 5-[(2-phenylacetyl)amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(Cc1ccccc1)Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C16H13NO5/c18-14(6-10-4-2-1-3-5-10)17-13-8-11(15(19)20)7-12(9-13)16(21)22/h1-5,7-9H,6H2,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | ULSUWEMSGVMQSC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |