C23H19NO5 — CID 45428443
5-(3,3-diphenylpropanoylamino)benzene-1,3-dicarboxylic acid (PubChem CID 45428443) has the molecular formula C23H19NO5 and a molecular weight of 389.41 g/mol. Its IUPAC name is 5-(3,3-diphenylpropanoylamino)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(3,3-diphenylpropanoylamino)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 45428443 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 5-(3,3-diphenylpropanoylamino)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C23H19NO5/c25-21(24-19-12-17(22(26)27)11-18(13-19)23(28)29)14-20(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,20H,14H2,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | KAFVJOAINXKYGN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |