C35H28N2O4 — CID 2261290
3,5-bis[(2,2-diphenylacetyl)amino]benzoic acid (PubChem CID 2261290) has the molecular formula C35H28N2O4 and a molecular weight of 540.62 g/mol. Its IUPAC name is 3,5-bis[(2,2-diphenylacetyl)amino]benzoic acid.
| Compound Name | 3,5-bis[(2,2-diphenylacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 2261290 |
| Molecular Formula | C35H28N2O4 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 3,5-bis[(2,2-diphenylacetyl)amino]benzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)C(c2ccccc2)c2ccccc2)cc(NC(=O)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C35H28N2O4/c38-33(31(24-13-5-1-6-14-24)25-15-7-2-8-16-25)36-29-21-28(35(40)41)22-30(23-29)37-34(39)32(26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-23,31-32H,(H,36,38)(H,37,39)(H,40,41) |
| InChIKey | MYOZSRODPCAOHM-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |