C50H38N4O2 — CID 4641253
N-[4-[6-[4-[(2,2-diphenylacetyl)amino]phenyl]-2-phenylpyrimidin-4-yl]phenyl]-2,2-diphenylacetamide (PubChem CID 4641253) has the molecular formula C50H38N4O2 and a molecular weight of 726.88 g/mol. Its IUPAC name is N-[4-[6-[4-[(2,2-diphenylacetyl)amino]phenyl]-2-phenylpyrimidin-4-yl]phenyl]-2,2-diphenylacetamide.
| Compound Name | N-[4-[6-[4-[(2,2-diphenylacetyl)amino]phenyl]-2-phenylpyrimidin-4-yl]phenyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 4641253 |
| Molecular Formula | C50H38N4O2 |
| Molecular Weight | 726.88 g/mol |
| Exact Mass | 726.30 |
| IUPAC Name | N-[4-[6-[4-[(2,2-diphenylacetyl)amino]phenyl]-2-phenylpyrimidin-4-yl]phenyl]-2,2-diphenylacetamide |
| SMILES | O=C(Nc1ccc(-c2cc(-c3ccc(NC(=O)C(c4ccccc4)c4ccccc4)cc3)nc(-c3ccccc3)n2)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H38N4O2/c55-49(46(37-16-6-1-7-17-37)38-18-8-2-9-19-38)51-42-30-26-35(27-31-42)44-34-45(54-48(53-44)41-24-14-5-15-25-41)36-28-32-43(33-29-36)52-50(56)47(39-20-10-3-11-21-39)40-22-12-4-13-23-40/h1-34,46-47H,(H,51,55)(H,52,56) |
| InChIKey | CLIIBDHKONVORU-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.88 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |