C26H23N3O2 — CID 41089435
N-[4-(6-ethoxypyridazin-3-yl)phenyl]-2,2-diphenylacetamide (PubChem CID 41089435) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[4-(6-ethoxypyridazin-3-yl)phenyl]-2,2-diphenylacetamide.
| Compound Name | N-[4-(6-ethoxypyridazin-3-yl)phenyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 41089435 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-[4-(6-ethoxypyridazin-3-yl)phenyl]-2,2-diphenylacetamide |
| SMILES | CCOc1ccc(-c2ccc(NC(=O)C(c3ccccc3)c3ccccc3)cc2)nn1 |
| InChI | InChI=1S/C26H23N3O2/c1-2-31-24-18-17-23(28-29-24)19-13-15-22(16-14-19)27-26(30)25(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-18,25H,2H2,1H3,(H,27,30) |
| InChIKey | WQIMULIGLCDISA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |