C23H25N3O4 — CID 7596485
3,4-diethoxy-N-[4-(6-ethoxypyridazin-3-yl)phenyl]benzamide (PubChem CID 7596485) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3,4-diethoxy-N-[4-(6-ethoxypyridazin-3-yl)phenyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[4-(6-ethoxypyridazin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 7596485 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3,4-diethoxy-N-[4-(6-ethoxypyridazin-3-yl)phenyl]benzamide |
| SMILES | CCOc1ccc(-c2ccc(NC(=O)c3ccc(OCC)c(OCC)c3)cc2)nn1 |
| InChI | InChI=1S/C23H25N3O4/c1-4-28-20-13-9-17(15-21(20)29-5-2)23(27)24-18-10-7-16(8-11-18)19-12-14-22(26-25-19)30-6-3/h7-15H,4-6H2,1-3H3,(H,24,27) |
| InChIKey | LGYWOVDKVOHINC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |