C20H15F2NO — CID 887699
N-(3,4-difluorophenyl)-2,2-diphenylacetamide (PubChem CID 887699) has the molecular formula C20H15F2NO and a molecular weight of 323.34 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2,2-diphenylacetamide.
| Compound Name | N-(3,4-difluorophenyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 887699 |
| Molecular Formula | C20H15F2NO |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-2,2-diphenylacetamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15F2NO/c21-17-12-11-16(13-18(17)22)23-20(24)19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,19H,(H,23,24) |
| InChIKey | MOEGHDZHDQDRKN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |