3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid

C10H9F2NO3 — CID 114896864

IUPAC3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid
SMILESCC(C(=O)O)C(=O)Nc1ccc(F)c(F)c1
InChIInChI=1S/C10H9F2NO3/c1-5(10(15)16)9(14)13-6-2-3-7(11)8(12)4-6/h2-5H,1H3,(H,13,14)(H,15,16)
InChIKeyBBKPOIDRIAESSR-UHFFFAOYSA-N
MW229.18 g/mol
LogP1.62
Rot. Bonds3

About 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid

3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid (PubChem CID 114896864) has the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. Its IUPAC name is 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid.

Molecular Properties

Compound Name3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid
PubChem CID114896864
Molecular FormulaC10H9F2NO3
Molecular Weight229.18 g/mol
Exact Mass229.06
IUPAC Name3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid
SMILESCC(C(=O)O)C(=O)Nc1ccc(F)c(F)c1
InChIInChI=1S/C10H9F2NO3/c1-5(10(15)16)9(14)13-6-2-3-7(11)8(12)4-6/h2-5H,1H3,(H,13,14)(H,15,16)
InChIKeyBBKPOIDRIAESSR-UHFFFAOYSA-N
XLogP1.62
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.18
LogP ≤ 51.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid?
The IUPAC name of 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid (CID 114896864) is 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid.
What is the SMILES notation for 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid?
The canonical SMILES for 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid is CC(C(=O)O)C(=O)Nc1ccc(F)c(F)c1.
What is the InChIKey of 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid?
The InChIKey is BBKPOIDRIAESSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2NO3/c1-5(10(15)16)9(14)13-6-2-3-7(11)8(12)4-6/h2-5H,1H3,(H,13,14)(H,15,16).
What are the key properties of 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid?
3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid has a molecular weight of 229.18 g/mol, XLogP of 1.62, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid is sourced from PubChem (CID 114896864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).