C10H9F2NO3 — CID 114896864
3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid (PubChem CID 114896864) has the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. Its IUPAC name is 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114896864 |
| Molecular Formula | C10H9F2NO3 |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 3-(3,4-difluoroanilino)-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H9F2NO3/c1-5(10(15)16)9(14)13-6-2-3-7(11)8(12)4-6/h2-5H,1H3,(H,13,14)(H,15,16) |
| InChIKey | BBKPOIDRIAESSR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|