C15H12F4N2O — CID 51248549
2-(3,4-difluoroanilino)-N-(3,4-difluorophenyl)propanamide (PubChem CID 51248549) has the molecular formula C15H12F4N2O and a molecular weight of 312.27 g/mol. Its IUPAC name is 2-(3,4-difluoroanilino)-N-(3,4-difluorophenyl)propanamide.
| Compound Name | 2-(3,4-difluoroanilino)-N-(3,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 51248549 |
| Molecular Formula | C15H12F4N2O |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-(3,4-difluoroanilino)-N-(3,4-difluorophenyl)propanamide |
| SMILES | CC(Nc1ccc(F)c(F)c1)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H12F4N2O/c1-8(20-9-2-4-11(16)13(18)6-9)15(22)21-10-3-5-12(17)14(19)7-10/h2-8,20H,1H3,(H,21,22) |
| InChIKey | VOIUCAZDIMHUFW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |