C14H18F2N2O3 — CID 43184932
tert-butyl N-[1-(3,4-difluoroanilino)-1-oxopropan-2-yl]carbamate (PubChem CID 43184932) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is tert-butyl N-[1-(3,4-difluoroanilino)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3,4-difluoroanilino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 43184932 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | tert-butyl N-[1-(3,4-difluoroanilino)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H18F2N2O3/c1-8(17-13(20)21-14(2,3)4)12(19)18-9-5-6-10(15)11(16)7-9/h5-8H,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | ORJDMTJDKPWDBT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |