C15H20ClFN2O3 — CID 91297307
tert-butyl N-[1-(3-chloro-4-fluoro-5-methylanilino)-1-oxopropan-2-yl]carbamate (PubChem CID 91297307) has the molecular formula C15H20ClFN2O3 and a molecular weight of 330.79 g/mol. Its IUPAC name is tert-butyl N-[1-(3-chloro-4-fluoro-5-methylanilino)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-chloro-4-fluoro-5-methylanilino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 91297307 |
| Molecular Formula | C15H20ClFN2O3 |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | tert-butyl N-[1-(3-chloro-4-fluoro-5-methylanilino)-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1cc(NC(=O)C(C)NC(=O)OC(C)(C)C)cc(Cl)c1F |
| InChI | InChI=1S/C15H20ClFN2O3/c1-8-6-10(7-11(16)12(8)17)19-13(20)9(2)18-14(21)22-15(3,4)5/h6-7,9H,1-5H3,(H,18,21)(H,19,20) |
| InChIKey | NKLGRVSBRVRLQL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |