C17H24Cl2N2O4 — CID 70444747
tert-butyl N-[(2S)-1-(3,5-dichloro-4-hydroxyanilino)-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 70444747) has the molecular formula C17H24Cl2N2O4 and a molecular weight of 391.30 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(3,5-dichloro-4-hydroxyanilino)-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(3,5-dichloro-4-hydroxyanilino)-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 70444747 |
| Molecular Formula | C17H24Cl2N2O4 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | tert-butyl N-[(2S)-1-(3,5-dichloro-4-hydroxyanilino)-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C17H24Cl2N2O4/c1-9(2)6-13(21-16(24)25-17(3,4)5)15(23)20-10-7-11(18)14(22)12(19)8-10/h7-9,13,22H,6H2,1-5H3,(H,20,23)(H,21,24)/t13-/m0/s1 |
| InChIKey | SYCBWBYEPAMHII-ZDUSSCGKSA-N |
| XLogP | 4.58 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|