C18H27BrN2O3 — CID 165404735
tert-butyl N-[(2R)-1-(4-bromo-3-methylanilino)-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 165404735) has the molecular formula C18H27BrN2O3 and a molecular weight of 399.33 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(4-bromo-3-methylanilino)-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(4-bromo-3-methylanilino)-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 165404735 |
| Molecular Formula | C18H27BrN2O3 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | tert-butyl N-[(2R)-1-(4-bromo-3-methylanilino)-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | Cc1cc(NC(=O)[C@@H](CC(C)C)NC(=O)OC(C)(C)C)ccc1Br |
| InChI | InChI=1S/C18H27BrN2O3/c1-11(2)9-15(21-17(23)24-18(4,5)6)16(22)20-13-7-8-14(19)12(3)10-13/h7-8,10-11,15H,9H2,1-6H3,(H,20,22)(H,21,23)/t15-/m1/s1 |
| InChIKey | XVZQXONUNQAFAW-OAHLLOKOSA-N |
| XLogP | 4.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |