C16H24N2O3 — CID 14440786
tert-butyl N-[1-(3,5-dimethylanilino)-1-oxopropan-2-yl]carbamate (PubChem CID 14440786) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl N-[1-(3,5-dimethylanilino)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3,5-dimethylanilino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 14440786 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | tert-butyl N-[1-(3,5-dimethylanilino)-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1cc(C)cc(NC(=O)C(C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H24N2O3/c1-10-7-11(2)9-13(8-10)18-14(19)12(3)17-15(20)21-16(4,5)6/h7-9,12H,1-6H3,(H,17,20)(H,18,19) |
| InChIKey | GRHJKWHWEXLLBF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |