C13H18F2N2O — CID 43116673
N-butan-2-yl-2-(3,4-difluoroanilino)propanamide (PubChem CID 43116673) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is N-butan-2-yl-2-(3,4-difluoroanilino)propanamide.
| Compound Name | N-butan-2-yl-2-(3,4-difluoroanilino)propanamide |
|---|---|
| PubChem CID | 43116673 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-butan-2-yl-2-(3,4-difluoroanilino)propanamide |
| SMILES | CCC(C)NC(=O)C(C)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H18F2N2O/c1-4-8(2)16-13(18)9(3)17-10-5-6-11(14)12(15)7-10/h5-9,17H,4H2,1-3H3,(H,16,18) |
| InChIKey | SSJMOBLWDZLHOR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |