C21H19ClN2O — CID 28866941
N-(3-amino-4-chlorophenyl)-3,3-diphenylpropanamide (PubChem CID 28866941) has the molecular formula C21H19ClN2O and a molecular weight of 350.85 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-3,3-diphenylpropanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 28866941 |
| Molecular Formula | C21H19ClN2O |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-3,3-diphenylpropanamide |
| SMILES | Nc1cc(NC(=O)CC(c2ccccc2)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C21H19ClN2O/c22-19-12-11-17(13-20(19)23)24-21(25)14-18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,18H,14,23H2,(H,24,25) |
| InChIKey | INVPDUQVRGBCMN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|