C27H29N3O3 — CID 1370326
N-tert-butyl-3,5-bis[(2-phenylacetyl)amino]benzamide (PubChem CID 1370326) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-tert-butyl-3,5-bis[(2-phenylacetyl)amino]benzamide.
| Compound Name | N-tert-butyl-3,5-bis[(2-phenylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 1370326 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-tert-butyl-3,5-bis[(2-phenylacetyl)amino]benzamide |
| SMILES | CC(C)(C)NC(=O)c1cc(NC(=O)Cc2ccccc2)cc(NC(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C27H29N3O3/c1-27(2,3)30-26(33)21-16-22(28-24(31)14-19-10-6-4-7-11-19)18-23(17-21)29-25(32)15-20-12-8-5-9-13-20/h4-13,16-18H,14-15H2,1-3H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | JMJBZYHZNOGDIS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |