C19H20F2N2O3 — CID 139348508
N-tert-butyl-3-[[2-(4,5-difluoro-2-hydroxyphenyl)acetyl]amino]benzamide (PubChem CID 139348508) has the molecular formula C19H20F2N2O3 and a molecular weight of 362.38 g/mol. Its IUPAC name is N-tert-butyl-3-[[2-(4,5-difluoro-2-hydroxyphenyl)acetyl]amino]benzamide.
| Compound Name | N-tert-butyl-3-[[2-(4,5-difluoro-2-hydroxyphenyl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 139348508 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-tert-butyl-3-[[2-(4,5-difluoro-2-hydroxyphenyl)acetyl]amino]benzamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(NC(=O)Cc2cc(F)c(F)cc2O)c1 |
| InChI | InChI=1S/C19H20F2N2O3/c1-19(2,3)23-18(26)11-5-4-6-13(7-11)22-17(25)9-12-8-14(20)15(21)10-16(12)24/h4-8,10,24H,9H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | SFHMJQJNJXMIRJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |