C14H10N2O7 — CID 156760584
5-[(3-carboxy-2,5-dihydroxybenzoyl)amino]pyridine-3-carboxylic acid (PubChem CID 156760584) has the molecular formula C14H10N2O7 and a molecular weight of 318.24 g/mol. Its IUPAC name is 5-[(3-carboxy-2,5-dihydroxybenzoyl)amino]pyridine-3-carboxylic acid.
| Compound Name | 5-[(3-carboxy-2,5-dihydroxybenzoyl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 156760584 |
| Molecular Formula | C14H10N2O7 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 5-[(3-carboxy-2,5-dihydroxybenzoyl)amino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(NC(=O)c2cc(O)cc(C(=O)O)c2O)c1 |
| InChI | InChI=1S/C14H10N2O7/c17-8-2-9(11(18)10(3-8)14(22)23)12(19)16-7-1-6(13(20)21)4-15-5-7/h1-5,17-18H,(H,16,19)(H,20,21)(H,22,23) |
| InChIKey | NLNCZPXFLFFXAK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|