C13H8ClNO6 — CID 106683355
5-[(2-chlorofuran-3-carbonyl)amino]benzene-1,3-dicarboxylic acid (PubChem CID 106683355) has the molecular formula C13H8ClNO6 and a molecular weight of 309.66 g/mol. Its IUPAC name is 5-[(2-chlorofuran-3-carbonyl)amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(2-chlorofuran-3-carbonyl)amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 106683355 |
| Molecular Formula | C13H8ClNO6 |
| Molecular Weight | 309.66 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 5-[(2-chlorofuran-3-carbonyl)amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2ccoc2Cl)cc(C(=O)O)c1 |
| InChI | InChI=1S/C13H8ClNO6/c14-10-9(1-2-21-10)11(16)15-8-4-6(12(17)18)3-7(5-8)13(19)20/h1-5H,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | LTHOSGYMTRYYDK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.66 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |