C13H8ClN3O4 — CID 106686038
2-chloro-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)furan-3-carboxamide (PubChem CID 106686038) has the molecular formula C13H8ClN3O4 and a molecular weight of 305.68 g/mol. Its IUPAC name is 2-chloro-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)furan-3-carboxamide.
| Compound Name | 2-chloro-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106686038 |
| Molecular Formula | C13H8ClN3O4 |
| Molecular Weight | 305.68 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 2-chloro-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)furan-3-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]c(=O)c(=O)[nH]c2c1)c1ccoc1Cl |
| InChI | InChI=1S/C13H8ClN3O4/c14-10-7(3-4-21-10)11(18)15-6-1-2-8-9(5-6)17-13(20)12(19)16-8/h1-5H,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | UNIUAIAAIBOVIC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.68 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|