C14H12ClNO4 — CID 106913105
2-chloro-N-[3-(1,3-dioxolan-2-yl)phenyl]furan-3-carboxamide (PubChem CID 106913105) has the molecular formula C14H12ClNO4 and a molecular weight of 293.71 g/mol. Its IUPAC name is 2-chloro-N-[3-(1,3-dioxolan-2-yl)phenyl]furan-3-carboxamide.
| Compound Name | 2-chloro-N-[3-(1,3-dioxolan-2-yl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106913105 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-chloro-N-[3-(1,3-dioxolan-2-yl)phenyl]furan-3-carboxamide |
| SMILES | O=C(Nc1cccc(C2OCCO2)c1)c1ccoc1Cl |
| InChI | InChI=1S/C14H12ClNO4/c15-12-11(4-5-18-12)13(17)16-10-3-1-2-9(8-10)14-19-6-7-20-14/h1-5,8,14H,6-7H2,(H,16,17) |
| InChIKey | LVVBCMVJIWUNNN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |