C14H12ClN3O3 — CID 107372233
5-chloro-N-[3-(1,3-dioxolan-2-yl)phenyl]pyrazine-2-carboxamide (PubChem CID 107372233) has the molecular formula C14H12ClN3O3 and a molecular weight of 305.72 g/mol. Its IUPAC name is 5-chloro-N-[3-(1,3-dioxolan-2-yl)phenyl]pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-[3-(1,3-dioxolan-2-yl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107372233 |
| Molecular Formula | C14H12ClN3O3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 5-chloro-N-[3-(1,3-dioxolan-2-yl)phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1cccc(C2OCCO2)c1)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C14H12ClN3O3/c15-12-8-16-11(7-17-12)13(19)18-10-3-1-2-9(6-10)14-20-4-5-21-14/h1-3,6-8,14H,4-5H2,(H,18,19) |
| InChIKey | PZBNGQJXHPQWAI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |