C15H13BrN2O3 — CID 106913106
5-bromo-N-[3-(1,3-dioxolan-2-yl)phenyl]pyridine-2-carboxamide (PubChem CID 106913106) has the molecular formula C15H13BrN2O3 and a molecular weight of 349.18 g/mol. Its IUPAC name is 5-bromo-N-[3-(1,3-dioxolan-2-yl)phenyl]pyridine-2-carboxamide.
| Compound Name | 5-bromo-N-[3-(1,3-dioxolan-2-yl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106913106 |
| Molecular Formula | C15H13BrN2O3 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 5-bromo-N-[3-(1,3-dioxolan-2-yl)phenyl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1cccc(C2OCCO2)c1)c1ccc(Br)cn1 |
| InChI | InChI=1S/C15H13BrN2O3/c16-11-4-5-13(17-9-11)14(19)18-12-3-1-2-10(8-12)15-20-6-7-21-15/h1-5,8-9,15H,6-7H2,(H,18,19) |
| InChIKey | WSXBWDPLVYGTCV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |