C14H18BrNO3 — CID 107910768
5-bromo-N-[3-(1,3-dioxolan-2-yl)phenyl]pentanamide (PubChem CID 107910768) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is 5-bromo-N-[3-(1,3-dioxolan-2-yl)phenyl]pentanamide.
| Compound Name | 5-bromo-N-[3-(1,3-dioxolan-2-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 107910768 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 5-bromo-N-[3-(1,3-dioxolan-2-yl)phenyl]pentanamide |
| SMILES | O=C(CCCCBr)Nc1cccc(C2OCCO2)c1 |
| InChI | InChI=1S/C14H18BrNO3/c15-7-2-1-6-13(17)16-12-5-3-4-11(10-12)14-18-8-9-19-14/h3-5,10,14H,1-2,6-9H2,(H,16,17) |
| InChIKey | CAAOSNOXCVWTOC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|