C15H15NO3S — CID 847833
N-[3-(1,3-dioxan-2-yl)phenyl]thiophene-2-carboxamide (PubChem CID 847833) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-[3-(1,3-dioxan-2-yl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-(1,3-dioxan-2-yl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 847833 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | N-[3-(1,3-dioxan-2-yl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(C2OCCCO2)c1)c1cccs1 |
| InChI | InChI=1S/C15H15NO3S/c17-14(13-6-2-9-20-13)16-12-5-1-4-11(10-12)15-18-7-3-8-19-15/h1-2,4-6,9-10,15H,3,7-8H2,(H,16,17) |
| InChIKey | BIVHKXOESNLHLX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |