C16H17N3O3S — CID 119701038
N-[3-(thiophene-2-carbonylamino)phenyl]morpholine-3-carboxamide (PubChem CID 119701038) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-[3-(thiophene-2-carbonylamino)phenyl]morpholine-3-carboxamide.
| Compound Name | N-[3-(thiophene-2-carbonylamino)phenyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119701038 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[3-(thiophene-2-carbonylamino)phenyl]morpholine-3-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)C2COCCN2)c1)c1cccs1 |
| InChI | InChI=1S/C16H17N3O3S/c20-15(13-10-22-7-6-17-13)18-11-3-1-4-12(9-11)19-16(21)14-5-2-8-23-14/h1-5,8-9,13,17H,6-7,10H2,(H,18,20)(H,19,21) |
| InChIKey | RSQWKNWHRDPLMV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |