C16H18ClN3O3S — CID 119759053
N-[4-(thiophene-2-carbonylamino)phenyl]morpholine-3-carboxamide;hydrochloride (PubChem CID 119759053) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is N-[4-(thiophene-2-carbonylamino)phenyl]morpholine-3-carboxamide;hydrochloride.
| Compound Name | N-[4-(thiophene-2-carbonylamino)phenyl]morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119759053 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[4-(thiophene-2-carbonylamino)phenyl]morpholine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(NC(=O)C2COCCN2)cc1)c1cccs1 |
| InChI | InChI=1S/C16H17N3O3S.ClH/c20-15(13-10-22-8-7-17-13)18-11-3-5-12(6-4-11)19-16(21)14-2-1-9-23-14;/h1-6,9,13,17H,7-8,10H2,(H,18,20)(H,19,21);1H |
| InChIKey | SQNIYHXHFLFDLW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |