C17H13N3O3S — CID 31518553
1-oxido-N-[3-(thiophene-2-carbonylamino)phenyl]pyridin-1-ium-3-carboxamide (PubChem CID 31518553) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 1-oxido-N-[3-(thiophene-2-carbonylamino)phenyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-oxido-N-[3-(thiophene-2-carbonylamino)phenyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 31518553 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 1-oxido-N-[3-(thiophene-2-carbonylamino)phenyl]pyridin-1-ium-3-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2cccs2)c1)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C17H13N3O3S/c21-16(12-4-2-8-20(23)11-12)18-13-5-1-6-14(10-13)19-17(22)15-7-3-9-24-15/h1-11H,(H,18,21)(H,19,22) |
| InChIKey | BDRKXSGMPGFKFR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 85.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|