C23H17N3O4S — CID 55831993
N-[3-[[3-(thiophene-2-carbonylamino)phenyl]carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 55831993) has the molecular formula C23H17N3O4S and a molecular weight of 431.47 g/mol. Its IUPAC name is N-[3-[[3-(thiophene-2-carbonylamino)phenyl]carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[3-(thiophene-2-carbonylamino)phenyl]carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55831993 |
| Molecular Formula | C23H17N3O4S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | N-[3-[[3-(thiophene-2-carbonylamino)phenyl]carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2cccs2)c1)c1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C23H17N3O4S/c27-21(15-5-1-6-16(13-15)25-22(28)19-9-3-11-30-19)24-17-7-2-8-18(14-17)26-23(29)20-10-4-12-31-20/h1-14H,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | LBSIQKQUNOBBJI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |