C23H16N2O5S — CID 86953657
[3-(thiophene-2-carbonylamino)phenyl] 4-(furan-2-carbonylamino)benzoate (PubChem CID 86953657) has the molecular formula C23H16N2O5S and a molecular weight of 432.46 g/mol. Its IUPAC name is [3-(thiophene-2-carbonylamino)phenyl] 4-(furan-2-carbonylamino)benzoate.
| Compound Name | [3-(thiophene-2-carbonylamino)phenyl] 4-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 86953657 |
| Molecular Formula | C23H16N2O5S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | [3-(thiophene-2-carbonylamino)phenyl] 4-(furan-2-carbonylamino)benzoate |
| SMILES | O=C(Oc1cccc(NC(=O)c2cccs2)c1)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C23H16N2O5S/c26-21(19-6-2-12-29-19)24-16-10-8-15(9-11-16)23(28)30-18-5-1-4-17(14-18)25-22(27)20-7-3-13-31-20/h1-14H,(H,24,26)(H,25,27) |
| InChIKey | CLKVCVFLINLAME-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|