C20H17NO4 — CID 761866
(3,4-dimethylphenyl) 4-(furan-2-carbonylamino)benzoate (PubChem CID 761866) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 4-(furan-2-carbonylamino)benzoate.
| Compound Name | (3,4-dimethylphenyl) 4-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 761866 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (3,4-dimethylphenyl) 4-(furan-2-carbonylamino)benzoate |
| SMILES | Cc1ccc(OC(=O)c2ccc(NC(=O)c3ccco3)cc2)cc1C |
| InChI | InChI=1S/C20H17NO4/c1-13-5-10-17(12-14(13)2)25-20(23)15-6-8-16(9-7-15)21-19(22)18-4-3-11-24-18/h3-12H,1-2H3,(H,21,22) |
| InChIKey | JWXWILKTPOXEQQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|