C22H20N2O3 — CID 51045899
N-[4-[[(E)-3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]amino]phenyl]furan-2-carboxamide (PubChem CID 51045899) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[4-[[(E)-3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[(E)-3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51045899 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[4-[[(E)-3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]amino]phenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)/C=C/Nc2ccc(NC(=O)c3ccco3)cc2)cc1C |
| InChI | InChI=1S/C22H20N2O3/c1-15-5-6-17(14-16(15)2)20(25)11-12-23-18-7-9-19(10-8-18)24-22(26)21-4-3-13-27-21/h3-14,23H,1-2H3,(H,24,26)/b12-11+ |
| InChIKey | XWSQHUGAQKXRIH-VAWYXSNFSA-N |
| XLogP | 4.96 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|