C18H16F3NO2 — CID 51045927
(E)-1-(3,4-dimethylphenyl)-3-[4-(trifluoromethoxy)anilino]prop-2-en-1-one (PubChem CID 51045927) has the molecular formula C18H16F3NO2 and a molecular weight of 335.33 g/mol. Its IUPAC name is (E)-1-(3,4-dimethylphenyl)-3-[4-(trifluoromethoxy)anilino]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dimethylphenyl)-3-[4-(trifluoromethoxy)anilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 51045927 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (E)-1-(3,4-dimethylphenyl)-3-[4-(trifluoromethoxy)anilino]prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)/C=C/Nc2ccc(OC(F)(F)F)cc2)cc1C |
| InChI | InChI=1S/C18H16F3NO2/c1-12-3-4-14(11-13(12)2)17(23)9-10-22-15-5-7-16(8-6-15)24-18(19,20)21/h3-11,22H,1-2H3/b10-9+ |
| InChIKey | CUEAHYYJAVHVEF-MDZDMXLPSA-N |
| XLogP | 5.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|