C16H18N2O2S — CID 7268815
N-[3-[[(2S)-2-methylbutanoyl]amino]phenyl]thiophene-2-carboxamide (PubChem CID 7268815) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is N-[3-[[(2S)-2-methylbutanoyl]amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[(2S)-2-methylbutanoyl]amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 7268815 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[3-[[(2S)-2-methylbutanoyl]amino]phenyl]thiophene-2-carboxamide |
| SMILES | CC[C@H](C)C(=O)Nc1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C16H18N2O2S/c1-3-11(2)15(19)17-12-6-4-7-13(10-12)18-16(20)14-8-5-9-21-14/h4-11H,3H2,1-2H3,(H,17,19)(H,18,20)/t11-/m0/s1 |
| InChIKey | UXUJVCMHDWDUDJ-NSHDSACASA-N |
| XLogP | 3.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |