C17H22ClN3O2S — CID 119701089
N-[3-[(2-amino-2-methylpentanoyl)amino]phenyl]thiophene-2-carboxamide;hydrochloride (PubChem CID 119701089) has the molecular formula C17H22ClN3O2S and a molecular weight of 367.90 g/mol. Its IUPAC name is N-[3-[(2-amino-2-methylpentanoyl)amino]phenyl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[(2-amino-2-methylpentanoyl)amino]phenyl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119701089 |
| Molecular Formula | C17H22ClN3O2S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[3-[(2-amino-2-methylpentanoyl)amino]phenyl]thiophene-2-carboxamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)Nc1cccc(NC(=O)c2cccs2)c1.Cl |
| InChI | InChI=1S/C17H21N3O2S.ClH/c1-3-9-17(2,18)16(22)20-13-7-4-6-12(11-13)19-15(21)14-8-5-10-23-14;/h4-8,10-11H,3,9,18H2,1-2H3,(H,19,21)(H,20,22);1H |
| InChIKey | XRQCQLDEYBUDRL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |