C13H18F2N2OS — CID 119770554
2-amino-N-[3-(difluoromethylsulfanyl)phenyl]-2-methylpentanamide (PubChem CID 119770554) has the molecular formula C13H18F2N2OS and a molecular weight of 288.36 g/mol. Its IUPAC name is 2-amino-N-[3-(difluoromethylsulfanyl)phenyl]-2-methylpentanamide.
| Compound Name | 2-amino-N-[3-(difluoromethylsulfanyl)phenyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 119770554 |
| Molecular Formula | C13H18F2N2OS |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-amino-N-[3-(difluoromethylsulfanyl)phenyl]-2-methylpentanamide |
| SMILES | CCCC(C)(N)C(=O)Nc1cccc(SC(F)F)c1 |
| InChI | InChI=1S/C13H18F2N2OS/c1-3-7-13(2,16)11(18)17-9-5-4-6-10(8-9)19-12(14)15/h4-6,8,12H,3,7,16H2,1-2H3,(H,17,18) |
| InChIKey | AYLXGZNOIVVPIR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |