C10H13ClF2N2OS — CID 119770523
N-[3-(difluoromethylsulfanyl)phenyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 119770523) has the molecular formula C10H13ClF2N2OS and a molecular weight of 282.74 g/mol. Its IUPAC name is N-[3-(difluoromethylsulfanyl)phenyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[3-(difluoromethylsulfanyl)phenyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119770523 |
| Molecular Formula | C10H13ClF2N2OS |
| Molecular Weight | 282.74 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | N-[3-(difluoromethylsulfanyl)phenyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CNCC(=O)Nc1cccc(SC(F)F)c1.Cl |
| InChI | InChI=1S/C10H12F2N2OS.ClH/c1-13-6-9(15)14-7-3-2-4-8(5-7)16-10(11)12;/h2-5,10,13H,6H2,1H3,(H,14,15);1H |
| InChIKey | HJNWKKXFIAEZDD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.74 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |