C12H17ClF2N2O2S — CID 120591461
4-amino-N-[3-(difluoromethylsulfanyl)phenyl]-3-methoxybutanamide;hydrochloride (PubChem CID 120591461) has the molecular formula C12H17ClF2N2O2S and a molecular weight of 326.80 g/mol. Its IUPAC name is 4-amino-N-[3-(difluoromethylsulfanyl)phenyl]-3-methoxybutanamide;hydrochloride.
| Compound Name | 4-amino-N-[3-(difluoromethylsulfanyl)phenyl]-3-methoxybutanamide;hydrochloride |
|---|---|
| PubChem CID | 120591461 |
| Molecular Formula | C12H17ClF2N2O2S |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 4-amino-N-[3-(difluoromethylsulfanyl)phenyl]-3-methoxybutanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)Nc1cccc(SC(F)F)c1.Cl |
| InChI | InChI=1S/C12H16F2N2O2S.ClH/c1-18-9(7-15)6-11(17)16-8-3-2-4-10(5-8)19-12(13)14;/h2-5,9,12H,6-7,15H2,1H3,(H,16,17);1H |
| InChIKey | VICUBTPPBVUHOX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |